C25H20Cl2N2O — CID 17241256
4-(2,3-dichlorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide (PubChem CID 17241256) has the molecular formula C25H20Cl2N2O and a molecular weight of 435.35 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide.
| Compound Name | 4-(2,3-dichlorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 17241256 |
| Molecular Formula | C25H20Cl2N2O |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cccc2c1NC(c1cccc(Cl)c1Cl)C1CC=CC21 |
| InChI | InChI=1S/C25H20Cl2N2O/c26-21-14-6-12-19(22(21)27)23-17-10-4-9-16(17)18-11-5-13-20(24(18)29-23)25(30)28-15-7-2-1-3-8-15/h1-9,11-14,16-17,23,29H,10H2,(H,28,30) |
| InChIKey | ROMCUPBDOZVDSM-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|