C18H19NS — CID 17237569
8-methyl-4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17237569) has the molecular formula C18H19NS and a molecular weight of 281.42 g/mol. Its IUPAC name is 8-methyl-4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-methyl-4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17237569 |
| Molecular Formula | C18H19NS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 8-methyl-4-(5-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc2c(c1)C1C=CCC1C(c1ccc(C)s1)N2 |
| InChI | InChI=1S/C18H19NS/c1-11-6-8-16-15(10-11)13-4-3-5-14(13)18(19-16)17-9-7-12(2)20-17/h3-4,6-10,13-14,18-19H,5H2,1-2H3 |
| InChIKey | YJOQURWVUBQCTL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|