C22H18N2O2 — CID 124677871
(11R,15S,16R)-16-(3-nitrophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene (PubChem CID 124677871) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (11R,15S,16R)-16-(3-nitrophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene.
| Compound Name | (11R,15S,16R)-16-(3-nitrophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene |
|---|---|
| PubChem CID | 124677871 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (11R,15S,16R)-16-(3-nitrophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene |
| SMILES | O=[N+]([O-])c1cccc([C@@H]2Nc3c(ccc4ccccc34)[C@@H]3C=CC[C@@H]32)c1 |
| InChI | InChI=1S/C22H18N2O2/c25-24(26)16-7-3-6-15(13-16)21-19-10-4-9-18(19)20-12-11-14-5-1-2-8-17(14)22(20)23-21/h1-9,11-13,18-19,21,23H,10H2/t18-,19+,21+/m1/s1 |
| InChIKey | DRXABWVRGDLOCX-DYXWJJEUSA-N |
| XLogP | 5.57 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|