C22H18FN — CID 126159831
(11R,15R,16R)-16-(3-fluorophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene (PubChem CID 126159831) has the molecular formula C22H18FN and a molecular weight of 315.39 g/mol. Its IUPAC name is (11R,15R,16R)-16-(3-fluorophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene.
| Compound Name | (11R,15R,16R)-16-(3-fluorophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene |
|---|---|
| PubChem CID | 126159831 |
| Molecular Formula | C22H18FN |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (11R,15R,16R)-16-(3-fluorophenyl)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaene |
| SMILES | Fc1cccc([C@@H]2Nc3c(ccc4ccccc34)[C@@H]3C=CC[C@H]32)c1 |
| InChI | InChI=1S/C22H18FN/c23-16-7-3-6-15(13-16)21-19-10-4-9-18(19)20-12-11-14-5-1-2-8-17(14)22(20)24-21/h1-9,11-13,18-19,21,24H,10H2/t18-,19-,21+/m1/s1 |
| InChIKey | IHMSWUVYBPHBEK-SBHAEUEKSA-N |
| XLogP | 5.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|