C24H21NO2 — CID 7366829
methyl 4-[(11R,15R,16R)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaen-16-yl]benzoate (PubChem CID 7366829) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 4-[(11R,15R,16R)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaen-16-yl]benzoate.
| Compound Name | methyl 4-[(11R,15R,16R)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaen-16-yl]benzoate |
|---|---|
| PubChem CID | 7366829 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl 4-[(11R,15R,16R)-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12-hexaen-16-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3c(ccc4ccccc34)[C@@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C24H21NO2/c1-27-24(26)17-11-9-16(10-12-17)22-20-8-4-7-19(20)21-14-13-15-5-2-3-6-18(15)23(21)25-22/h2-7,9-14,19-20,22,25H,8H2,1H3/t19-,20-,22+/m1/s1 |
| InChIKey | AUYZUYKXLPVXBH-SJBKTWHCSA-N |
| XLogP | 5.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|