C14H11F3NO3- — CID 7200351
(3aR,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 7200351) has the molecular formula C14H11F3NO3- and a molecular weight of 298.24 g/mol. Its IUPAC name is (3aR,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | (3aR,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7200351 |
| Molecular Formula | C14H11F3NO3- |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (3aR,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | O=C([O-])[C@@H]1Nc2ccc(OC(F)(F)F)cc2[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C14H12F3NO3/c15-14(16,17)21-7-4-5-11-10(6-7)8-2-1-3-9(8)12(18-11)13(19)20/h1-2,4-6,8-9,12,18H,3H2,(H,19,20)/p-1/t8-,9+,12+/m0/s1 |
| InChIKey | AXSHRZCSKZMLCK-YGOYTEALSA-M |
| XLogP | 1.79 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|