C19H15ClF3NO2 — CID 124674077
4-[(3aS,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-chlorophenol (PubChem CID 124674077) has the molecular formula C19H15ClF3NO2 and a molecular weight of 381.78 g/mol. Its IUPAC name is 4-[(3aS,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-chlorophenol.
| Compound Name | 4-[(3aS,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-chlorophenol |
|---|---|
| PubChem CID | 124674077 |
| Molecular Formula | C19H15ClF3NO2 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[(3aS,4R,9bS)-8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-3-chlorophenol |
| SMILES | Oc1ccc([C@@H]2Nc3ccc(OC(F)(F)F)cc3[C@H]3C=CC[C@@H]32)c(Cl)c1 |
| InChI | InChI=1S/C19H15ClF3NO2/c20-16-8-10(25)4-6-14(16)18-13-3-1-2-12(13)15-9-11(26-19(21,22)23)5-7-17(15)24-18/h1-2,4-9,12-13,18,24-25H,3H2/t12-,13-,18+/m0/s1 |
| InChIKey | RRAIWZOTEWYJKL-ZJNRKIDTSA-N |
| XLogP | 5.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|