C17H17F3N2O4 — CID 16738633
methyl 2-[[8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carbonyl]amino]acetate (PubChem CID 16738633) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl 2-[[8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 16738633 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl 2-[[8-(trifluoromethoxy)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1Nc2ccc(OC(F)(F)F)cc2C2C=CCC12 |
| InChI | InChI=1S/C17H17F3N2O4/c1-25-14(23)8-21-16(24)15-11-4-2-3-10(11)12-7-9(26-17(18,19)20)5-6-13(12)22-15/h2-3,5-7,10-11,15,22H,4,8H2,1H3,(H,21,24) |
| InChIKey | JVUFPOMZCQWWOS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|