C18H19N2O3- — CID 11914645
(3aS,4S,9bS)-6-(pyrrolidine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 11914645) has the molecular formula C18H19N2O3- and a molecular weight of 311.36 g/mol. Its IUPAC name is (3aS,4S,9bS)-6-(pyrrolidine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | (3aS,4S,9bS)-6-(pyrrolidine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 11914645 |
| Molecular Formula | C18H19N2O3- |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (3aS,4S,9bS)-6-(pyrrolidine-1-carbonyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | O=C([O-])[C@H]1Nc2c(C(=O)N3CCCC3)cccc2[C@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C18H20N2O3/c21-17(20-9-1-2-10-20)14-8-4-6-12-11-5-3-7-13(11)16(18(22)23)19-15(12)14/h3-6,8,11,13,16,19H,1-2,7,9-10H2,(H,22,23)/p-1/t11-,13+,16+/m1/s1 |
| InChIKey | SLERUHSLMRNVML-FFSVYQOJSA-M |
| XLogP | 1.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|