C33H26BrClN2O6S — CID 99667920
(2-methoxycarbonylphenyl) (1R,2S,3aS,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 99667920) has the molecular formula C33H26BrClN2O6S and a molecular weight of 694.00 g/mol. Its IUPAC name is (2-methoxycarbonylphenyl) (1R,2S,3aS,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | (2-methoxycarbonylphenyl) (1R,2S,3aS,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 99667920 |
| Molecular Formula | C33H26BrClN2O6S |
| Molecular Weight | 694.00 g/mol |
| Exact Mass | 692.04 |
| IUPAC Name | (2-methoxycarbonylphenyl) (1R,2S,3aS,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccccc1OC(=O)c1ccc2c(c1)[C@@H]1[C@@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@@H]1[C@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C33H26BrClN2O6S/c1-42-33(39)21-6-2-4-8-26(21)43-32(38)19-12-15-24-22(16-19)29-23(31(36-24)18-10-13-20(34)14-11-18)17-28(30(29)35)44-27-9-5-3-7-25(27)37(40)41/h2-16,23,28-31,36H,17H2,1H3/t23-,28-,29-,30-,31-/m0/s1 |
| InChIKey | ITEUNMLJIJCQRD-LAMIVESZSA-N |
| XLogP | 8.40 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.00 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|