C26H22BrClN2O3S — CID 100860854
1-[(1S,2R,3aR,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone (PubChem CID 100860854) has the molecular formula C26H22BrClN2O3S and a molecular weight of 557.90 g/mol. Its IUPAC name is 1-[(1S,2R,3aR,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone.
| Compound Name | 1-[(1S,2R,3aR,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 100860854 |
| Molecular Formula | C26H22BrClN2O3S |
| Molecular Weight | 557.90 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | 1-[(1S,2R,3aR,4R,9bR)-4-(4-bromophenyl)-1-chloro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-8-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C26H22BrClN2O3S/c1-14(31)16-8-11-20-18(12-16)24-19(26(29-20)15-6-9-17(27)10-7-15)13-23(25(24)28)34-22-5-3-2-4-21(22)30(32)33/h2-12,19,23-26,29H,13H2,1H3/t19-,23-,24+,25-,26+/m1/s1 |
| InChIKey | ZOQLLVCOPXRYKP-FRTMRTDSSA-N |
| XLogP | 7.60 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.90 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|