C26H22ClFN2O4S — CID 3122743
methyl 1-chloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 3122743) has the molecular formula C26H22ClFN2O4S and a molecular weight of 512.99 g/mol. Its IUPAC name is methyl 1-chloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | methyl 1-chloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 3122743 |
| Molecular Formula | C26H22ClFN2O4S |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | methyl 1-chloro-4-(4-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1C(Cl)C(Sc3ccccc3[N+](=O)[O-])CC1C(c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C26H22ClFN2O4S/c1-34-26(31)15-8-11-19-17(12-15)23-18(25(29-19)14-6-9-16(28)10-7-14)13-22(24(23)27)35-21-5-3-2-4-20(21)30(32)33/h2-12,18,22-25,29H,13H2,1H3 |
| InChIKey | SVWCEXBIHIIPFN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|