C27H23Cl3N2O4S — CID 100868385
ethyl (1S,2R,3aR,4S,9bR)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 100868385) has the molecular formula C27H23Cl3N2O4S and a molecular weight of 577.92 g/mol. Its IUPAC name is ethyl (1S,2R,3aR,4S,9bR)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | ethyl (1S,2R,3aR,4S,9bR)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 100868385 |
| Molecular Formula | C27H23Cl3N2O4S |
| Molecular Weight | 577.92 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | ethyl (1S,2R,3aR,4S,9bR)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@@H](c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C27H23Cl3N2O4S/c1-2-36-27(33)14-7-10-20-17(11-14)24-18(26(31-20)16-9-8-15(28)12-19(16)29)13-23(25(24)30)37-22-6-4-3-5-21(22)32(34)35/h3-12,18,23-26,31H,2,13H2,1H3/t18-,23-,24+,25-,26-/m1/s1 |
| InChIKey | KCDKIKPDHLMOAY-ABNLYDASSA-N |
| XLogP | 8.12 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.92 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|