C26H21Cl3N2O4S — CID 124772968
methyl (1R,2S,3aR,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate (PubChem CID 124772968) has the molecular formula C26H21Cl3N2O4S and a molecular weight of 563.89 g/mol. Its IUPAC name is methyl (1R,2S,3aR,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate.
| Compound Name | methyl (1R,2S,3aR,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 124772968 |
| Molecular Formula | C26H21Cl3N2O4S |
| Molecular Weight | 563.89 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | methyl (1R,2S,3aR,4S,9bS)-1-chloro-4-(2,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate |
| SMILES | COC(=O)c1cccc2c1N[C@H](c1ccc(Cl)cc1Cl)[C@@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@H](Cl)[C@H]21 |
| InChI | InChI=1S/C26H21Cl3N2O4S/c1-35-26(32)16-6-4-5-15-22-17(24(30-25(15)16)14-10-9-13(27)11-18(14)28)12-21(23(22)29)36-20-8-3-2-7-19(20)31(33)34/h2-11,17,21-24,30H,12H2,1H3/t17-,21+,22-,23+,24-/m1/s1 |
| InChIKey | POIMRNZXDNXRME-JYTHNSPOSA-N |
| XLogP | 7.73 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.89 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|