C24H18Cl3N3O4S — CID 98052958
(1S,2S,3aR,4R,9bR)-1,6,8-trichloro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 98052958) has the molecular formula C24H18Cl3N3O4S and a molecular weight of 550.85 g/mol. Its IUPAC name is (1S,2S,3aR,4R,9bR)-1,6,8-trichloro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (1S,2S,3aR,4R,9bR)-1,6,8-trichloro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 98052958 |
| Molecular Formula | C24H18Cl3N3O4S |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | (1S,2S,3aR,4R,9bR)-1,6,8-trichloro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2Nc3c(Cl)cc(Cl)cc3[C@@H]3[C@H](Cl)[C@@H](Sc4ccccc4[N+](=O)[O-])C[C@H]32)cc1 |
| InChI | InChI=1S/C24H18Cl3N3O4S/c25-13-9-15-21-16(11-20(22(21)27)35-19-4-2-1-3-18(19)30(33)34)23(28-24(15)17(26)10-13)12-5-7-14(8-6-12)29(31)32/h1-10,16,20-23,28H,11H2/t16-,20+,21+,22-,23+/m1/s1 |
| InChIKey | VDAIXJBXHUVLFU-XVAAYUMESA-N |
| XLogP | 7.85 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|