C25H21ClIN3O4S — CID 99649657
(1S,2R,3aR,4R,9bS)-1-chloro-8-iodo-6-methyl-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 99649657) has the molecular formula C25H21ClIN3O4S and a molecular weight of 621.88 g/mol. Its IUPAC name is (1S,2R,3aR,4R,9bS)-1-chloro-8-iodo-6-methyl-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (1S,2R,3aR,4R,9bS)-1-chloro-8-iodo-6-methyl-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 99649657 |
| Molecular Formula | C25H21ClIN3O4S |
| Molecular Weight | 621.88 g/mol |
| Exact Mass | 621.00 |
| IUPAC Name | (1S,2R,3aR,4R,9bS)-1-chloro-8-iodo-6-methyl-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(I)cc2c1N[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1C[C@@H](Sc3ccccc3[N+](=O)[O-])[C@@H](Cl)[C@H]21 |
| InChI | InChI=1S/C25H21ClIN3O4S/c1-13-10-15(27)11-17-22-18(25(28-24(13)17)14-6-8-16(9-7-14)29(31)32)12-21(23(22)26)35-20-5-3-2-4-19(20)30(33)34/h2-11,18,21-23,25,28H,12H2,1H3/t18-,21-,22-,23-,25+/m1/s1 |
| InChIKey | MQUWKNXIIOYLCQ-LPVRMUPLSA-N |
| XLogP | 7.45 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.88 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|