C28H22ClN3O4S — CID 11874924
(12R,13S,15S,16R,17R)-16-chloro-12-(4-nitrophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene (PubChem CID 11874924) has the molecular formula C28H22ClN3O4S and a molecular weight of 532.02 g/mol. Its IUPAC name is (12R,13S,15S,16R,17R)-16-chloro-12-(4-nitrophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (12R,13S,15S,16R,17R)-16-chloro-12-(4-nitrophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 11874924 |
| Molecular Formula | C28H22ClN3O4S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | (12R,13S,15S,16R,17R)-16-chloro-12-(4-nitrophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2Nc3ccc4ccccc4c3[C@@H]3[C@@H](Cl)[C@@H](Sc4ccccc4[N+](=O)[O-])C[C@@H]32)cc1 |
| InChI | InChI=1S/C28H22ClN3O4S/c29-27-24(37-23-8-4-3-7-22(23)32(35)36)15-20-26(27)25-19-6-2-1-5-16(19)11-14-21(25)30-28(20)17-9-12-18(13-10-17)31(33)34/h1-14,20,24,26-28,30H,15H2/t20-,24-,26+,27-,28-/m0/s1 |
| InChIKey | GUTBZWPDHFRXQM-ULDNNVLMSA-N |
| XLogP | 7.69 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|