C28H22ClFN2O2S — CID 124767289
(12R,13S,15R,16S,17S)-16-chloro-12-(2-fluorophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene (PubChem CID 124767289) has the molecular formula C28H22ClFN2O2S and a molecular weight of 505.01 g/mol. Its IUPAC name is (12R,13S,15R,16S,17S)-16-chloro-12-(2-fluorophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (12R,13S,15R,16S,17S)-16-chloro-12-(2-fluorophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 124767289 |
| Molecular Formula | C28H22ClFN2O2S |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | (12R,13S,15R,16S,17S)-16-chloro-12-(2-fluorophenyl)-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
| SMILES | O=[N+]([O-])c1ccccc1S[C@@H]1C[C@H]2[C@@H](c3c(ccc4ccccc34)N[C@H]2c2ccccc2F)[C@@H]1Cl |
| InChI | InChI=1S/C28H22ClFN2O2S/c29-27-24(35-23-12-6-5-11-22(23)32(33)34)15-19-26(27)25-17-8-2-1-7-16(17)13-14-21(25)31-28(19)18-9-3-4-10-20(18)30/h1-14,19,24,26-28,31H,15H2/t19-,24+,26-,27+,28-/m0/s1 |
| InChIKey | FCEVFWRDUFKIQW-HTOAFJFDSA-N |
| XLogP | 7.93 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|