C26H23ClFN3O5S — CID 3373508
1-chloro-8-ethoxy-4-(2-fluorophenyl)-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 3373508) has the molecular formula C26H23ClFN3O5S and a molecular weight of 544.00 g/mol. Its IUPAC name is 1-chloro-8-ethoxy-4-(2-fluorophenyl)-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | 1-chloro-8-ethoxy-4-(2-fluorophenyl)-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 3373508 |
| Molecular Formula | C26H23ClFN3O5S |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 1-chloro-8-ethoxy-4-(2-fluorophenyl)-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | CCOc1cc2c(c([N+](=O)[O-])c1)NC(c1ccccc1F)C1CC(Sc3ccccc3[N+](=O)[O-])C(Cl)C21 |
| InChI | InChI=1S/C26H23ClFN3O5S/c1-2-36-14-11-16-23-17(13-22(24(23)27)37-21-10-6-5-9-19(21)30(32)33)25(15-7-3-4-8-18(15)28)29-26(16)20(12-14)31(34)35/h3-12,17,22-25,29H,2,13H2,1H3 |
| InChIKey | LYVIKIIUGCTGSK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|