C24H19BrClFN2O2S — CID 98277451
(1S,2R,3aS,4R,9bS)-8-bromo-1-chloro-4-(2-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 98277451) has the molecular formula C24H19BrClFN2O2S and a molecular weight of 533.85 g/mol. Its IUPAC name is (1S,2R,3aS,4R,9bS)-8-bromo-1-chloro-4-(2-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (1S,2R,3aS,4R,9bS)-8-bromo-1-chloro-4-(2-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 98277451 |
| Molecular Formula | C24H19BrClFN2O2S |
| Molecular Weight | 533.85 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | (1S,2R,3aS,4R,9bS)-8-bromo-1-chloro-4-(2-fluorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | O=[N+]([O-])c1ccccc1S[C@@H]1C[C@H]2[C@@H](c3cc(Br)ccc3N[C@H]2c2ccccc2F)[C@@H]1Cl |
| InChI | InChI=1S/C24H19BrClFN2O2S/c25-13-9-10-18-15(11-13)22-16(24(28-18)14-5-1-2-6-17(14)27)12-21(23(22)26)32-20-8-4-3-7-19(20)29(30)31/h1-11,16,21-24,28H,12H2/t16-,21+,22+,23+,24-/m0/s1 |
| InChIKey | ZGQBLUUGPANQGY-ZDJAMIHNSA-N |
| XLogP | 7.53 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.85 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|