C21H20ClN3O7S — CID 5115417
1-chloro-8-ethoxy-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 5115417) has the molecular formula C21H20ClN3O7S and a molecular weight of 493.93 g/mol. Its IUPAC name is 1-chloro-8-ethoxy-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | 1-chloro-8-ethoxy-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 5115417 |
| Molecular Formula | C21H20ClN3O7S |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 1-chloro-8-ethoxy-6-nitro-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | CCOc1cc2c(c([N+](=O)[O-])c1)NC(C(=O)O)C1CC(Sc3ccccc3[N+](=O)[O-])C(Cl)C21 |
| InChI | InChI=1S/C21H20ClN3O7S/c1-2-32-10-7-11-17-12(20(21(26)27)23-19(11)14(8-10)25(30)31)9-16(18(17)22)33-15-6-4-3-5-13(15)24(28)29/h3-8,12,16-18,20,23H,2,9H2,1H3,(H,26,27) |
| InChIKey | ZLCVMBPYKMFEKF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|