C20H18Cl2N2O4S — CID 129449086
(1R,2S,3aR,4S,9bR)-1,6-dichloro-7-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 129449086) has the molecular formula C20H18Cl2N2O4S and a molecular weight of 453.35 g/mol. Its IUPAC name is (1R,2S,3aR,4S,9bR)-1,6-dichloro-7-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | (1R,2S,3aR,4S,9bR)-1,6-dichloro-7-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 129449086 |
| Molecular Formula | C20H18Cl2N2O4S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (1R,2S,3aR,4S,9bR)-1,6-dichloro-7-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | Cc1ccc2c(c1Cl)N[C@H](C(=O)O)[C@@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@H](Cl)[C@@H]21 |
| InChI | InChI=1S/C20H18Cl2N2O4S/c1-9-6-7-10-15-11(19(20(25)26)23-18(10)16(9)21)8-14(17(15)22)29-13-5-3-2-4-12(13)24(27)28/h2-7,11,14-15,17,19,23H,8H2,1H3,(H,25,26)/t11-,14+,15+,17+,19+/m1/s1 |
| InChIKey | YCLFNFMIGLHWRQ-SRXGNBAJSA-N |
| XLogP | 5.31 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|