C23H19ClN2O4S — CID 51423272
(12R,13S,15S,16R,17S)-16-chloro-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene-12-carboxylic acid (PubChem CID 51423272) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is (12R,13S,15S,16R,17S)-16-chloro-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene-12-carboxylic acid.
| Compound Name | (12R,13S,15S,16R,17S)-16-chloro-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene-12-carboxylic acid |
|---|---|
| PubChem CID | 51423272 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (12R,13S,15S,16R,17S)-16-chloro-15-(2-nitrophenyl)sulfanyl-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene-12-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Nc2ccc3ccccc3c2[C@H]2[C@@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@@H]21 |
| InChI | InChI=1S/C23H19ClN2O4S/c24-21-18(31-17-8-4-3-7-16(17)26(29)30)11-14-20(21)19-13-6-2-1-5-12(13)9-10-15(19)25-22(14)23(27)28/h1-10,14,18,20-22,25H,11H2,(H,27,28)/t14-,18-,20-,21-,22+/m0/s1 |
| InChIKey | RWKZLLKUCHKAOS-DUFDLUDNSA-N |
| XLogP | 5.50 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|