C20H19ClN2O4S — CID 6550195
(1S,2R,3aR,4S,9bS)-1-chloro-8-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 6550195) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is (1S,2R,3aR,4S,9bS)-1-chloro-8-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | (1S,2R,3aR,4S,9bS)-1-chloro-8-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 6550195 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (1S,2R,3aR,4S,9bS)-1-chloro-8-methyl-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | Cc1ccc2c(c1)[C@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@@H](C(=O)O)N2 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-10-6-7-13-11(8-10)17-12(19(22-13)20(24)25)9-16(18(17)21)28-15-5-3-2-4-14(15)23(26)27/h2-8,12,16-19,22H,9H2,1H3,(H,24,25)/t12-,16-,17-,18-,19+/m1/s1 |
| InChIKey | PCNNYBRPMHVQJI-FXJWEYNDSA-N |
| XLogP | 4.65 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|