C24H22ClN3O4S2 — CID 124766873
(1S,2R,3aS,4R,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 124766873) has the molecular formula C24H22ClN3O4S2 and a molecular weight of 516.04 g/mol. Its IUPAC name is (1S,2R,3aS,4R,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (1S,2R,3aS,4R,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 124766873 |
| Molecular Formula | C24H22ClN3O4S2 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | (1S,2R,3aS,4R,9bR)-1-chloro-2-(2-nitrophenyl)sulfanyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@H](Sc3ccccc3[N+](=O)[O-])C[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C24H22ClN3O4S2/c25-23-21(33-20-9-5-4-8-19(20)28(29)30)13-17-22(23)16-12-15(34(26,31)32)10-11-18(16)27-24(17)14-6-2-1-3-7-14/h1-12,17,21-24,27H,13H2,(H2,26,31,32)/t17-,21+,22-,23+,24-/m0/s1 |
| InChIKey | XLQGIDCCNPDMRP-FPVDIDMMSA-N |
| XLogP | 5.28 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|