C24H21Cl2N3O4S2 — CID 11920124
(1S,2S,3aR,4R,9bR)-1-chloro-4-(4-chlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 11920124) has the molecular formula C24H21Cl2N3O4S2 and a molecular weight of 550.49 g/mol. Its IUPAC name is (1S,2S,3aR,4R,9bR)-1-chloro-4-(4-chlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (1S,2S,3aR,4R,9bR)-1-chloro-4-(4-chlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 11920124 |
| Molecular Formula | C24H21Cl2N3O4S2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | (1S,2S,3aR,4R,9bR)-1-chloro-4-(4-chlorophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)[C@@H]1[C@H](Cl)[C@@H](Sc3ccccc3[N+](=O)[O-])C[C@H]1[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C24H21Cl2N3O4S2/c25-14-7-5-13(6-8-14)24-17-12-21(34-20-4-2-1-3-19(20)29(30)31)23(26)22(17)16-11-15(35(27,32)33)9-10-18(16)28-24/h1-11,17,21-24,28H,12H2,(H2,27,32,33)/t17-,21+,22+,23-,24+/m1/s1 |
| InChIKey | WUFJXFLQFQGKDW-RNBKDOAQSA-N |
| XLogP | 5.93 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|