C25H19ClN4O8S — CID 11947508
(1S,2S,3aS,4R,9bR)-1-chloro-9-nitro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid (PubChem CID 11947508) has the molecular formula C25H19ClN4O8S and a molecular weight of 570.97 g/mol. Its IUPAC name is (1S,2S,3aS,4R,9bR)-1-chloro-9-nitro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid.
| Compound Name | (1S,2S,3aS,4R,9bR)-1-chloro-9-nitro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 11947508 |
| Molecular Formula | C25H19ClN4O8S |
| Molecular Weight | 570.97 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (1S,2S,3aS,4R,9bR)-1-chloro-9-nitro-4-(4-nitrophenyl)-2-(2-nitrophenyl)sulfanyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c2c1N[C@@H](c1ccc([N+](=O)[O-])cc1)[C@H]1C[C@H](Sc3ccccc3[N+](=O)[O-])[C@@H](Cl)[C@@H]21 |
| InChI | InChI=1S/C25H19ClN4O8S/c26-22-19(39-18-4-2-1-3-16(18)29(35)36)11-15-20(22)21-17(30(37)38)10-9-14(25(31)32)24(21)27-23(15)12-5-7-13(8-6-12)28(33)34/h1-10,15,19-20,22-23,27H,11H2,(H,31,32)/t15-,19-,20+,22+,23-/m0/s1 |
| InChIKey | FEWYYYBGTVKEFL-QUZHHRDCSA-N |
| XLogP | 6.15 |
| TPSA | 178.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.97 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|