C19H15N3O6 — CID 3125023
9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid (PubChem CID 3125023) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid.
| Compound Name | 9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 3125023 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c2c1NC(c1ccc([N+](=O)[O-])cc1)C1CC=CC21 |
| InChI | InChI=1S/C19H15N3O6/c23-19(24)14-8-9-15(22(27)28)16-12-2-1-3-13(12)17(20-18(14)16)10-4-6-11(7-5-10)21(25)26/h1-2,4-9,12-13,17,20H,3H2,(H,23,24) |
| InChIKey | PJWMSJZDTARCKR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|