C19H14N3O6- — CID 11898038
(3aR,4S,9bS)-9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate (PubChem CID 11898038) has the molecular formula C19H14N3O6- and a molecular weight of 380.34 g/mol. Its IUPAC name is (3aR,4S,9bS)-9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate.
| Compound Name | (3aR,4S,9bS)-9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 11898038 |
| Molecular Formula | C19H14N3O6- |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (3aR,4S,9bS)-9-nitro-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-6-carboxylate |
| SMILES | O=C([O-])c1ccc([N+](=O)[O-])c2c1N[C@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C19H15N3O6/c23-19(24)14-8-9-15(22(27)28)16-12-2-1-3-13(12)17(20-18(14)16)10-4-6-11(7-5-10)21(25)26/h1-2,4-9,12-13,17,20H,3H2,(H,23,24)/p-1/t12-,13+,17+/m0/s1 |
| InChIKey | PJWMSJZDTARCKR-OGHNNQOOSA-M |
| XLogP | 2.69 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|