C25H25ClN2O4S — CID 146574068
6-chloro-5-(2-nitrophenyl)sulfanyl-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-triene-2-carboxylic acid (PubChem CID 146574068) has the molecular formula C25H25ClN2O4S and a molecular weight of 485.01 g/mol. Its IUPAC name is 6-chloro-5-(2-nitrophenyl)sulfanyl-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-triene-2-carboxylic acid.
| Compound Name | 6-chloro-5-(2-nitrophenyl)sulfanyl-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 146574068 |
| Molecular Formula | C25H25ClN2O4S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 6-chloro-5-(2-nitrophenyl)sulfanyl-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-8,10,12(19)-triene-2-carboxylic acid |
| SMILES | O=C(O)C1C2CC(Sc3ccccc3[N+](=O)[O-])C(Cl)C2c2cccc3c2N1CC1CCCC31 |
| InChI | InChI=1S/C25H25ClN2O4S/c26-22-20(33-19-10-2-1-9-18(19)28(31)32)11-17-21(22)16-8-4-7-15-14-6-3-5-13(14)12-27(23(15)16)24(17)25(29)30/h1-2,4,7-10,13-14,17,20-22,24H,3,5-6,11-12H2,(H,29,30) |
| InChIKey | FROWARLGTOBXEP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|