C12H15NO6S — CID 125028457
(2S,3S,4R,5R,6S)-2-methyl-6-(2-nitrophenyl)sulfanyloxane-3,4,5-triol (PubChem CID 125028457) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-methyl-6-(2-nitrophenyl)sulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-methyl-6-(2-nitrophenyl)sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 125028457 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-methyl-6-(2-nitrophenyl)sulfanyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](Sc2ccccc2[N+](=O)[O-])[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15NO6S/c1-6-9(14)10(15)11(16)12(19-6)20-8-5-3-2-4-7(8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11+,12-/m0/s1 |
| InChIKey | XVVUGNDGMVOWSK-XQFKGYICSA-N |
| XLogP | 0.51 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|