C12H15NO7 — CID 70140220
(2S,3S,4S,5S,6R)-6-methyl-2-(2-nitrophenyl)oxane-2,3,4,5-tetrol (PubChem CID 70140220) has the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-6-methyl-2-(2-nitrophenyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6R)-6-methyl-2-(2-nitrophenyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 70140220 |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2S,3S,4S,5S,6R)-6-methyl-2-(2-nitrophenyl)oxane-2,3,4,5-tetrol |
| SMILES | C[C@H]1O[C@@](O)(c2ccccc2[N+](=O)[O-])[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15NO7/c1-6-9(14)10(15)11(16)12(17,20-6)7-4-2-3-5-8(7)13(18)19/h2-6,9-11,14-17H,1H3/t6-,9-,10+,11+,12+/m1/s1 |
| InChIKey | JIMQGYPDRFZILS-FDMIMSKNSA-N |
| XLogP | -0.76 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|