C18H18N2O5 — CID 24757626
methyl (3R,5R)-2-methyl-5-(2-nitrophenyl)-3-phenyl-1,2-oxazolidine-5-carboxylate (PubChem CID 24757626) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl (3R,5R)-2-methyl-5-(2-nitrophenyl)-3-phenyl-1,2-oxazolidine-5-carboxylate.
| Compound Name | methyl (3R,5R)-2-methyl-5-(2-nitrophenyl)-3-phenyl-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 24757626 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl (3R,5R)-2-methyl-5-(2-nitrophenyl)-3-phenyl-1,2-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2[N+](=O)[O-])C[C@H](c2ccccc2)N(C)O1 |
| InChI | InChI=1S/C18H18N2O5/c1-19-16(13-8-4-3-5-9-13)12-18(25-19,17(21)24-2)14-10-6-7-11-15(14)20(22)23/h3-11,16H,12H2,1-2H3/t16-,18-/m1/s1 |
| InChIKey | HGAWKZPXWWCGJO-SJLPKXTDSA-N |
| XLogP | 2.97 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|