C21H19N3O8 — CID 50994231
methyl (3R,6S,7aS)-6-(2,4-dinitrophenyl)-7a-methyl-5-oxo-3-phenyl-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole-6-carboxylate (PubChem CID 50994231) has the molecular formula C21H19N3O8 and a molecular weight of 441.40 g/mol. Its IUPAC name is methyl (3R,6S,7aS)-6-(2,4-dinitrophenyl)-7a-methyl-5-oxo-3-phenyl-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3R,6S,7aS)-6-(2,4-dinitrophenyl)-7a-methyl-5-oxo-3-phenyl-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 50994231 |
| Molecular Formula | C21H19N3O8 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | methyl (3R,6S,7aS)-6-(2,4-dinitrophenyl)-7a-methyl-5-oxo-3-phenyl-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C[C@]2(C)OC[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C21H19N3O8/c1-20-12-21(19(26)31-2,15-9-8-14(23(27)28)10-16(15)24(29)30)18(25)22(20)17(11-32-20)13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3/t17-,20-,21-/m0/s1 |
| InChIKey | JJJIQHVLKMNXAJ-YYWHXJBOSA-N |
| XLogP | 2.63 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|