C26H24N2O2 — CID 102430692
(2R,3R,3'S,7'aR)-7'a-methyl-2,3'-diphenylspiro[1,2-dihydroindole-3,6'-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole]-5'-one (PubChem CID 102430692) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2R,3R,3'S,7'aR)-7'a-methyl-2,3'-diphenylspiro[1,2-dihydroindole-3,6'-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole]-5'-one.
| Compound Name | (2R,3R,3'S,7'aR)-7'a-methyl-2,3'-diphenylspiro[1,2-dihydroindole-3,6'-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole]-5'-one |
|---|---|
| PubChem CID | 102430692 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2R,3R,3'S,7'aR)-7'a-methyl-2,3'-diphenylspiro[1,2-dihydroindole-3,6'-3,7-dihydro-2H-pyrrolo[2,1-b][1,3]oxazole]-5'-one |
| SMILES | C[C@@]12C[C@@]3(C(=O)N1[C@@H](c1ccccc1)CO2)c1ccccc1N[C@@H]3c1ccccc1 |
| InChI | InChI=1S/C26H24N2O2/c1-25-17-26(24(29)28(25)22(16-30-25)18-10-4-2-5-11-18)20-14-8-9-15-21(20)27-23(26)19-12-6-3-7-13-19/h2-15,22-23,27H,16-17H2,1H3/t22-,23-,25-,26-/m1/s1 |
| InChIKey | SKBOISBHVMEDLX-OQUNMALSSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |