C21H28N2O2 — CID 11013249
(1R,2R,4S,7S)-3-[(1R)-1-cyclohexylethyl]-1-methyl-7-phenyl-9-oxa-3,6-diazatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 11013249) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (1R,2R,4S,7S)-3-[(1R)-1-cyclohexylethyl]-1-methyl-7-phenyl-9-oxa-3,6-diazatricyclo[4.3.0.02,4]nonan-5-one.
| Compound Name | (1R,2R,4S,7S)-3-[(1R)-1-cyclohexylethyl]-1-methyl-7-phenyl-9-oxa-3,6-diazatricyclo[4.3.0.02,4]nonan-5-one |
|---|---|
| PubChem CID | 11013249 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (1R,2R,4S,7S)-3-[(1R)-1-cyclohexylethyl]-1-methyl-7-phenyl-9-oxa-3,6-diazatricyclo[4.3.0.02,4]nonan-5-one |
| SMILES | C[C@H](C1CCCCC1)N1[C@@H]2C(=O)N3[C@@H](c4ccccc4)CO[C@]3(C)[C@@H]21 |
| InChI | InChI=1S/C21H28N2O2/c1-14(15-9-5-3-6-10-15)22-18-19(22)21(2)23(20(18)24)17(13-25-21)16-11-7-4-8-12-16/h4,7-8,11-12,14-15,17-19H,3,5-6,9-10,13H2,1-2H3/t14-,17-,18+,19-,21-,22?/m1/s1 |
| InChIKey | XDGABOIQEJQSKM-RZHHWACASA-N |
| XLogP | 3.34 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|