C17H19NO2S2 — CID 98550157
(1'S,2'R,5'S,8'R)-1'-methyl-8'-phenylspiro[1,3-dithiolane-2,4'-10-oxa-7-azatricyclo[5.3.0.02,5]decane]-6'-one (PubChem CID 98550157) has the molecular formula C17H19NO2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (1'S,2'R,5'S,8'R)-1'-methyl-8'-phenylspiro[1,3-dithiolane-2,4'-10-oxa-7-azatricyclo[5.3.0.02,5]decane]-6'-one.
| Compound Name | (1'S,2'R,5'S,8'R)-1'-methyl-8'-phenylspiro[1,3-dithiolane-2,4'-10-oxa-7-azatricyclo[5.3.0.02,5]decane]-6'-one |
|---|---|
| PubChem CID | 98550157 |
| Molecular Formula | C17H19NO2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (1'S,2'R,5'S,8'R)-1'-methyl-8'-phenylspiro[1,3-dithiolane-2,4'-10-oxa-7-azatricyclo[5.3.0.02,5]decane]-6'-one |
| SMILES | C[C@@]12OC[C@@H](c3ccccc3)N1C(=O)[C@@H]1[C@H]2CC12SCCS2 |
| InChI | InChI=1S/C17H19NO2S2/c1-16-12-9-17(21-7-8-22-17)14(12)15(19)18(16)13(10-20-16)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+,14+,16+/m1/s1 |
| InChIKey | HRUYNPWKJWIJIR-HOSILWTGSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |