C23H19NO2 — CID 11439257
(2R,5R)-2-methyl-5-phenyl-3-oxa-6-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,14,16-hexaen-7-one (PubChem CID 11439257) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2R,5R)-2-methyl-5-phenyl-3-oxa-6-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,14,16-hexaen-7-one.
| Compound Name | (2R,5R)-2-methyl-5-phenyl-3-oxa-6-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,14,16-hexaen-7-one |
|---|---|
| PubChem CID | 11439257 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R,5R)-2-methyl-5-phenyl-3-oxa-6-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,14,16-hexaen-7-one |
| SMILES | C[C@]12OC[C@@H](c3ccccc3)N1C(=O)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C23H19NO2/c1-23-20-14-8-7-12-18(20)17-11-5-6-13-19(17)22(25)24(23)21(15-26-23)16-9-3-2-4-10-16/h2-14,21H,15H2,1H3/t21-,23+/m0/s1 |
| InChIKey | LLVPSNBBTLKFAX-JTHBVZDNSA-N |
| XLogP | 4.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |