C23H25BrN2O2 — CID 10599265
(1R,2R,5S,8R)-8-bromo-2-methyl-5-phenyl-10-[(1R)-1-phenylethyl]-3-oxa-6,10-diazatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 10599265) has the molecular formula C23H25BrN2O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is (1R,2R,5S,8R)-8-bromo-2-methyl-5-phenyl-10-[(1R)-1-phenylethyl]-3-oxa-6,10-diazatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1R,2R,5S,8R)-8-bromo-2-methyl-5-phenyl-10-[(1R)-1-phenylethyl]-3-oxa-6,10-diazatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 10599265 |
| Molecular Formula | C23H25BrN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (1R,2R,5S,8R)-8-bromo-2-methyl-5-phenyl-10-[(1R)-1-phenylethyl]-3-oxa-6,10-diazatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | C[C@H](c1ccccc1)N1C[C@H]2[C@@](Br)(C1)C(=O)N1[C@@H](c3ccccc3)CO[C@]21C |
| InChI | InChI=1S/C23H25BrN2O2/c1-16(17-9-5-3-6-10-17)25-13-20-22(2)26(21(27)23(20,24)15-25)19(14-28-22)18-11-7-4-8-12-18/h3-12,16,19-20H,13-15H2,1-2H3/t16-,19-,20-,22-,23+/m1/s1 |
| InChIKey | RXBXQFRZBAYEOI-MDPATALOSA-N |
| XLogP | 4.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|