C15H22N2 — CID 59203708
6-[(1S)-1-phenylethyl]-6-azaspiro[3.4]octan-8-amine (PubChem CID 59203708) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 6-[(1S)-1-phenylethyl]-6-azaspiro[3.4]octan-8-amine.
| Compound Name | 6-[(1S)-1-phenylethyl]-6-azaspiro[3.4]octan-8-amine |
|---|---|
| PubChem CID | 59203708 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 6-[(1S)-1-phenylethyl]-6-azaspiro[3.4]octan-8-amine |
| SMILES | C[C@@H](c1ccccc1)N1CC(N)C2(CCC2)C1 |
| InChI | InChI=1S/C15H22N2/c1-12(13-6-3-2-4-7-13)17-10-14(16)15(11-17)8-5-9-15/h2-4,6-7,12,14H,5,8-11,16H2,1H3/t12-,14?/m0/s1 |
| InChIKey | RUZDOUCRGPTJBM-NBFOIZRFSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |