C14H18FN — CID 163632981
(1R)-1-fluoro-3-[(1R)-1-phenylethyl]-3-azabicyclo[3.2.0]heptane (PubChem CID 163632981) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is (1R)-1-fluoro-3-[(1R)-1-phenylethyl]-3-azabicyclo[3.2.0]heptane.
| Compound Name | (1R)-1-fluoro-3-[(1R)-1-phenylethyl]-3-azabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 163632981 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (1R)-1-fluoro-3-[(1R)-1-phenylethyl]-3-azabicyclo[3.2.0]heptane |
| SMILES | C[C@H](c1ccccc1)N1CC2CC[C@]2(F)C1 |
| InChI | InChI=1S/C14H18FN/c1-11(12-5-3-2-4-6-12)16-9-13-7-8-14(13,15)10-16/h2-6,11,13H,7-10H2,1H3/t11-,13?,14+/m1/s1 |
| InChIKey | HXSBPIRRKVRHNS-VFXSIBAZSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |