C18H14N2O6 — CID 15206076
methyl 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate (PubChem CID 15206076) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is methyl 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate.
| Compound Name | methyl 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate |
|---|---|
| PubChem CID | 15206076 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carboxylate |
| SMILES | COC(=O)C12CCC(c3ccc([N+](=O)[O-])cc31)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C18H14N2O6/c1-26-17(21)18-7-6-12(13-4-2-10(19(22)23)8-15(13)18)14-5-3-11(20(24)25)9-16(14)18/h2-5,8-9,12H,6-7H2,1H3 |
| InChIKey | UCILVGHBRQORNU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|