C13H16N2O5 — CID 82046219
methyl 4-amino-2,2-dimethyl-6-nitro-3H-chromene-4-carboxylate (PubChem CID 82046219) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-amino-2,2-dimethyl-6-nitro-3H-chromene-4-carboxylate.
| Compound Name | methyl 4-amino-2,2-dimethyl-6-nitro-3H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 82046219 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 4-amino-2,2-dimethyl-6-nitro-3H-chromene-4-carboxylate |
| SMILES | COC(=O)C1(N)CC(C)(C)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H16N2O5/c1-12(2)7-13(14,11(16)19-3)9-6-8(15(17)18)4-5-10(9)20-12/h4-6H,7,14H2,1-3H3 |
| InChIKey | IIWFSVJYYDTBMU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|