C22H21N3O10S — CID 19987797
(2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl) 3-(3,5-dinitrobenzoyl)sulfanyl-2-methylpropanoate (PubChem CID 19987797) has the molecular formula C22H21N3O10S and a molecular weight of 519.49 g/mol. Its IUPAC name is (2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl) 3-(3,5-dinitrobenzoyl)sulfanyl-2-methylpropanoate.
| Compound Name | (2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl) 3-(3,5-dinitrobenzoyl)sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 19987797 |
| Molecular Formula | C22H21N3O10S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | (2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl) 3-(3,5-dinitrobenzoyl)sulfanyl-2-methylpropanoate |
| SMILES | CC(CSC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)OC1CC(C)(C)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H21N3O10S/c1-12(11-36-21(27)13-6-15(24(30)31)8-16(7-13)25(32)33)20(26)34-19-10-22(2,3)35-18-5-4-14(23(28)29)9-17(18)19/h4-9,12,19H,10-11H2,1-3H3 |
| InChIKey | WJEFCSLOARVHJN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 182.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|