C23H20BrCl2NO4S — CID 18647884
[(3R,4S)-3-bromo-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-3-(3,4-dichlorobenzoyl)sulfanyl-2-methylpropanoate (PubChem CID 18647884) has the molecular formula C23H20BrCl2NO4S and a molecular weight of 557.29 g/mol. Its IUPAC name is [(3R,4S)-3-bromo-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-3-(3,4-dichlorobenzoyl)sulfanyl-2-methylpropanoate.
| Compound Name | [(3R,4S)-3-bromo-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-3-(3,4-dichlorobenzoyl)sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 18647884 |
| Molecular Formula | C23H20BrCl2NO4S |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 554.97 |
| IUPAC Name | [(3R,4S)-3-bromo-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-3-(3,4-dichlorobenzoyl)sulfanyl-2-methylpropanoate |
| SMILES | C[C@H](CSC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1Br |
| InChI | InChI=1S/C23H20BrCl2NO4S/c1-12(11-32-22(29)14-5-6-16(25)17(26)9-14)21(28)30-19-15-8-13(10-27)4-7-18(15)31-23(2,3)20(19)24/h4-9,12,19-20H,11H2,1-3H3/t12-,19+,20-/m1/s1 |
| InChIKey | IGXPWFLWGAHYLD-OITMNORJSA-N |
| XLogP | 6.59 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|