C14H13BrFNO4 — CID 101189548
[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-2-bromo-2-fluoroacetate (PubChem CID 101189548) has the molecular formula C14H13BrFNO4 and a molecular weight of 358.16 g/mol. Its IUPAC name is [(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-2-bromo-2-fluoroacetate.
| Compound Name | [(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-2-bromo-2-fluoroacetate |
|---|---|
| PubChem CID | 101189548 |
| Molecular Formula | C14H13BrFNO4 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | [(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] (2S)-2-bromo-2-fluoroacetate |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](OC(=O)[C@@H](F)Br)[C@@H]1O |
| InChI | InChI=1S/C14H13BrFNO4/c1-14(2)11(18)10(20-13(19)12(15)16)8-5-7(6-17)3-4-9(8)21-14/h3-5,10-12,18H,1-2H3/t10-,11+,12-/m1/s1 |
| InChIKey | QXMPPXZAOAPGPY-GRYCIOLGSA-N |
| XLogP | 2.36 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|