About 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea
1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea (PubChem CID 54129414) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea |
| PubChem CID | 54129414 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea |
| SMILES | CNC(=O)NC1C(O)c2cc(C#N)ccc2OC1(C)C |
| InChI | InChI=1S/C14H17N3O3/c1-14(2)12(17-13(19)16-3)11(18)9-6-8(7-15)4-5-10(9)20-14/h4-6,11-12,18H,1-3H3,(H2,16,17,19) |
| InChIKey | NTHFQYTXUDYNHH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea?
The IUPAC name of 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea (CID 54129414) is 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea.
What is the SMILES notation for 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea?
The canonical SMILES for 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea is CNC(=O)NC1C(O)c2cc(C#N)ccc2OC1(C)C.
What is the InChIKey of 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea?
The InChIKey is NTHFQYTXUDYNHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-14(2)12(17-13(19)16-3)11(18)9-6-8(7-15)4-5-10(9)20-14/h4-6,11-12,18H,1-3H3,(H2,16,17,19).
What are the key properties of 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea?
1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea has a molecular weight of 275.31 g/mol, XLogP of 1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl)-3-methylurea is sourced from PubChem (CID 54129414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).