C16H18N2O4 — CID 18601769
N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-oxobutanamide (PubChem CID 18601769) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-oxobutanamide.
| Compound Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-oxobutanamide |
|---|---|
| PubChem CID | 18601769 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-oxobutanamide |
| SMILES | CCC(=O)C(=O)N[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C16H18N2O4/c1-4-11(19)15(21)18-13-10-7-9(8-17)5-6-12(10)22-16(2,3)14(13)20/h5-7,13-14,20H,4H2,1-3H3,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | JZNLMGMIGNRHDK-UONOGXRCSA-N |
| XLogP | 1.23 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|