C19H17N3O5 — CID 54279366
N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-nitrobenzamide (PubChem CID 54279366) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-nitrobenzamide.
| Compound Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 54279366 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-nitrobenzamide |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](NC(=O)c2cccc([N+](=O)[O-])c2)[C@H]1O |
| InChI | InChI=1S/C19H17N3O5/c1-19(2)17(23)16(14-8-11(10-20)6-7-15(14)27-19)21-18(24)12-4-3-5-13(9-12)22(25)26/h3-9,16-17,23H,1-2H3,(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | RPRYCBAKTKJULK-DLBZAZTESA-N |
| XLogP | 2.47 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|