C24H31N3O3Si — CID 54023580
N-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyridine-3-carboxamide (PubChem CID 54023580) has the molecular formula C24H31N3O3Si and a molecular weight of 437.62 g/mol. Its IUPAC name is N-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54023580 |
| Molecular Formula | C24H31N3O3Si |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyridine-3-carboxamide |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](NC(=O)c2cccnc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H31N3O3Si/c1-23(2,3)31(6,7)30-21-20(27-22(28)17-9-8-12-26-15-17)18-13-16(14-25)10-11-19(18)29-24(21,4)5/h8-13,15,20-21H,1-7H3,(H,27,28)/t20-,21+/m0/s1 |
| InChIKey | LAPMBWBKAGBGQS-LEWJYISDSA-N |
| XLogP | 4.99 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|